C28H36N4 — CID 68771029
2-N-[1-[(2S)-2-(dibenzylamino)propyl]piperidin-4-yl]benzene-1,2-diamine (PubChem CID 68771029) has the molecular formula C28H36N4 and a molecular weight of 428.62 g/mol. Its IUPAC name is 2-N-[1-[(2S)-2-(dibenzylamino)propyl]piperidin-4-yl]benzene-1,2-diamine.
| Compound Name | 2-N-[1-[(2S)-2-(dibenzylamino)propyl]piperidin-4-yl]benzene-1,2-diamine |
|---|---|
| PubChem CID | 68771029 |
| Molecular Formula | C28H36N4 |
| Molecular Weight | 428.62 g/mol |
| Exact Mass | 428.29 |
| IUPAC Name | 2-N-[1-[(2S)-2-(dibenzylamino)propyl]piperidin-4-yl]benzene-1,2-diamine |
| SMILES | C[C@@H](CN1CCC(Nc2ccccc2N)CC1)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C28H36N4/c1-23(20-31-18-16-26(17-19-31)30-28-15-9-8-14-27(28)29)32(21-24-10-4-2-5-11-24)22-25-12-6-3-7-13-25/h2-15,23,26,30H,16-22,29H2,1H3/t23-/m0/s1 |
| InChIKey | HPHKJSGDVNRFKW-QHCPKHFHSA-N |
| XLogP | 5.24 |
| TPSA | 44.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.62 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_NH_alk_D(2)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|