C20H35N3 — CID 146238813
2-N-(1-nonan-3-ylpiperidin-4-yl)benzene-1,2-diamine (PubChem CID 146238813) has the molecular formula C20H35N3 and a molecular weight of 317.52 g/mol. Its IUPAC name is 2-N-(1-nonan-3-ylpiperidin-4-yl)benzene-1,2-diamine.
| Compound Name | 2-N-(1-nonan-3-ylpiperidin-4-yl)benzene-1,2-diamine |
|---|---|
| PubChem CID | 146238813 |
| Molecular Formula | C20H35N3 |
| Molecular Weight | 317.52 g/mol |
| Exact Mass | 317.28 |
| IUPAC Name | 2-N-(1-nonan-3-ylpiperidin-4-yl)benzene-1,2-diamine |
| SMILES | CCCCCCC(CC)N1CCC(Nc2ccccc2N)CC1 |
| InChI | InChI=1S/C20H35N3/c1-3-5-6-7-10-18(4-2)23-15-13-17(14-16-23)22-20-12-9-8-11-19(20)21/h8-9,11-12,17-18,22H,3-7,10,13-16,21H2,1-2H3 |
| InChIKey | JPOKDRBSHGSDCM-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.52 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_NH_alk_D(2)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|