C35H40N4S — CID 87568572
1-[1-[2-(dibenzylamino)propyl]piperidin-4-yl]-1,3-diphenylthiourea (PubChem CID 87568572) has the molecular formula C35H40N4S and a molecular weight of 548.80 g/mol. Its IUPAC name is 1-[1-[2-(dibenzylamino)propyl]piperidin-4-yl]-1,3-diphenylthiourea.
| Compound Name | 1-[1-[2-(dibenzylamino)propyl]piperidin-4-yl]-1,3-diphenylthiourea |
|---|---|
| PubChem CID | 87568572 |
| Molecular Formula | C35H40N4S |
| Molecular Weight | 548.80 g/mol |
| Exact Mass | 548.30 |
| IUPAC Name | 1-[1-[2-(dibenzylamino)propyl]piperidin-4-yl]-1,3-diphenylthiourea |
| SMILES | CC(CN1CCC(N(C(=S)Nc2ccccc2)c2ccccc2)CC1)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C35H40N4S/c1-29(38(27-30-14-6-2-7-15-30)28-31-16-8-3-9-17-31)26-37-24-22-34(23-25-37)39(33-20-12-5-13-21-33)35(40)36-32-18-10-4-11-19-32/h2-21,29,34H,22-28H2,1H3,(H,36,40) |
| InChIKey | FALSZGQLSXZTND-UHFFFAOYSA-N |
| XLogP | 7.45 |
| TPSA | 21.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.80 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|