C19H22N2S — CID 14893622
1-benzyl-1-(1-cyclopropylethyl)-3-phenylthiourea (PubChem CID 14893622) has the molecular formula C19H22N2S and a molecular weight of 310.47 g/mol. Its IUPAC name is 1-benzyl-1-(1-cyclopropylethyl)-3-phenylthiourea.
| Compound Name | 1-benzyl-1-(1-cyclopropylethyl)-3-phenylthiourea |
|---|---|
| PubChem CID | 14893622 |
| Molecular Formula | C19H22N2S |
| Molecular Weight | 310.47 g/mol |
| Exact Mass | 310.15 |
| IUPAC Name | 1-benzyl-1-(1-cyclopropylethyl)-3-phenylthiourea |
| SMILES | CC(C1CC1)N(Cc1ccccc1)C(=S)Nc1ccccc1 |
| InChI | InChI=1S/C19H22N2S/c1-15(17-12-13-17)21(14-16-8-4-2-5-9-16)19(22)20-18-10-6-3-7-11-18/h2-11,15,17H,12-14H2,1H3,(H,20,22) |
| InChIKey | YFBGSSUAQFXIQK-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.47 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|