C20H23ClN2S — CID 8747442
1-benzyl-3-(3-chloro-2-methylphenyl)-1-[(1S)-1-cyclopropylethyl]thiourea (PubChem CID 8747442) has the molecular formula C20H23ClN2S and a molecular weight of 358.94 g/mol. Its IUPAC name is 1-benzyl-3-(3-chloro-2-methylphenyl)-1-[(1S)-1-cyclopropylethyl]thiourea.
| Compound Name | 1-benzyl-3-(3-chloro-2-methylphenyl)-1-[(1S)-1-cyclopropylethyl]thiourea |
|---|---|
| PubChem CID | 8747442 |
| Molecular Formula | C20H23ClN2S |
| Molecular Weight | 358.94 g/mol |
| Exact Mass | 358.13 |
| IUPAC Name | 1-benzyl-3-(3-chloro-2-methylphenyl)-1-[(1S)-1-cyclopropylethyl]thiourea |
| SMILES | Cc1c(Cl)cccc1NC(=S)N(Cc1ccccc1)[C@@H](C)C1CC1 |
| InChI | InChI=1S/C20H23ClN2S/c1-14-18(21)9-6-10-19(14)22-20(24)23(15(2)17-11-12-17)13-16-7-4-3-5-8-16/h3-10,15,17H,11-13H2,1-2H3,(H,22,24)/t15-/m0/s1 |
| InChIKey | ZUVMIGAQJKEDEX-HNNXBMFYSA-N |
| XLogP | 5.65 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.94 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|