C19H19ClN2O2S2 — CID 8790421
1-benzyl-3-(3-chloro-2-methylphenyl)-1-[(3S)-1,1-dioxo-2,3-dihydrothiophen-3-yl]thiourea (PubChem CID 8790421) has the molecular formula C19H19ClN2O2S2 and a molecular weight of 406.96 g/mol. Its IUPAC name is 1-benzyl-3-(3-chloro-2-methylphenyl)-1-[(3S)-1,1-dioxo-2,3-dihydrothiophen-3-yl]thiourea.
| Compound Name | 1-benzyl-3-(3-chloro-2-methylphenyl)-1-[(3S)-1,1-dioxo-2,3-dihydrothiophen-3-yl]thiourea |
|---|---|
| PubChem CID | 8790421 |
| Molecular Formula | C19H19ClN2O2S2 |
| Molecular Weight | 406.96 g/mol |
| Exact Mass | 406.06 |
| IUPAC Name | 1-benzyl-3-(3-chloro-2-methylphenyl)-1-[(3S)-1,1-dioxo-2,3-dihydrothiophen-3-yl]thiourea |
| SMILES | Cc1c(Cl)cccc1NC(=S)N(Cc1ccccc1)[C@H]1C=CS(=O)(=O)C1 |
| InChI | InChI=1S/C19H19ClN2O2S2/c1-14-17(20)8-5-9-18(14)21-19(25)22(12-15-6-3-2-4-7-15)16-10-11-26(23,24)13-16/h2-11,16H,12-13H2,1H3,(H,21,25)/t16-/m0/s1 |
| InChIKey | VTDNJEPFMZAOOU-INIZCTEOSA-N |
| XLogP | 4.16 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.96 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|