C18H18N2O2S2 — CID 129360570
1-benzyl-1-[(3R)-1,1-dioxo-2,3-dihydrothiophen-3-yl]-3-phenylthiourea (PubChem CID 129360570) has the molecular formula C18H18N2O2S2 and a molecular weight of 358.49 g/mol. Its IUPAC name is 1-benzyl-1-[(3R)-1,1-dioxo-2,3-dihydrothiophen-3-yl]-3-phenylthiourea.
| Compound Name | 1-benzyl-1-[(3R)-1,1-dioxo-2,3-dihydrothiophen-3-yl]-3-phenylthiourea |
|---|---|
| PubChem CID | 129360570 |
| Molecular Formula | C18H18N2O2S2 |
| Molecular Weight | 358.49 g/mol |
| Exact Mass | 358.08 |
| IUPAC Name | 1-benzyl-1-[(3R)-1,1-dioxo-2,3-dihydrothiophen-3-yl]-3-phenylthiourea |
| SMILES | O=S1(=O)C=C[C@@H](N(Cc2ccccc2)C(=S)Nc2ccccc2)C1 |
| InChI | InChI=1S/C18H18N2O2S2/c21-24(22)12-11-17(14-24)20(13-15-7-3-1-4-8-15)18(23)19-16-9-5-2-6-10-16/h1-12,17H,13-14H2,(H,19,23)/t17-/m1/s1 |
| InChIKey | VJJSFTRYGDRTDC-QGZVFWFLSA-N |
| XLogP | 3.20 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.49 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|