C20H22N2O2S2 — CID 8684399
1-benzyl-3-(3,4-dimethylphenyl)-1-[(3R)-1,1-dioxo-2,3-dihydrothiophen-3-yl]thiourea (PubChem CID 8684399) has the molecular formula C20H22N2O2S2 and a molecular weight of 386.54 g/mol. Its IUPAC name is 1-benzyl-3-(3,4-dimethylphenyl)-1-[(3R)-1,1-dioxo-2,3-dihydrothiophen-3-yl]thiourea.
| Compound Name | 1-benzyl-3-(3,4-dimethylphenyl)-1-[(3R)-1,1-dioxo-2,3-dihydrothiophen-3-yl]thiourea |
|---|---|
| PubChem CID | 8684399 |
| Molecular Formula | C20H22N2O2S2 |
| Molecular Weight | 386.54 g/mol |
| Exact Mass | 386.11 |
| IUPAC Name | 1-benzyl-3-(3,4-dimethylphenyl)-1-[(3R)-1,1-dioxo-2,3-dihydrothiophen-3-yl]thiourea |
| SMILES | Cc1ccc(NC(=S)N(Cc2ccccc2)[C@@H]2C=CS(=O)(=O)C2)cc1C |
| InChI | InChI=1S/C20H22N2O2S2/c1-15-8-9-18(12-16(15)2)21-20(25)22(13-17-6-4-3-5-7-17)19-10-11-26(23,24)14-19/h3-12,19H,13-14H2,1-2H3,(H,21,25)/t19-/m1/s1 |
| InChIKey | PBFGWUYSBAKEJR-LJQANCHMSA-N |
| XLogP | 3.81 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.54 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|