C21H30N3S+ — CID 8628523
3-[benzyl-[(3,4-dimethylphenyl)carbamothioyl]amino]propyl-dimethylazanium (PubChem CID 8628523) has the molecular formula C21H30N3S+ and a molecular weight of 356.56 g/mol. Its IUPAC name is 3-[benzyl-[(3,4-dimethylphenyl)carbamothioyl]amino]propyl-dimethylazanium.
| Compound Name | 3-[benzyl-[(3,4-dimethylphenyl)carbamothioyl]amino]propyl-dimethylazanium |
|---|---|
| PubChem CID | 8628523 |
| Molecular Formula | C21H30N3S+ |
| Molecular Weight | 356.56 g/mol |
| Exact Mass | 356.22 |
| IUPAC Name | 3-[benzyl-[(3,4-dimethylphenyl)carbamothioyl]amino]propyl-dimethylazanium |
| SMILES | Cc1ccc(NC(=S)N(CCC[NH+](C)C)Cc2ccccc2)cc1C |
| InChI | InChI=1S/C21H29N3S/c1-17-11-12-20(15-18(17)2)22-21(25)24(14-8-13-23(3)4)16-19-9-6-5-7-10-19/h5-7,9-12,15H,8,13-14,16H2,1-4H3,(H,22,25)/p+1 |
| InChIKey | QXRULGOJWZHHER-UHFFFAOYSA-O |
| XLogP | 3.04 |
| TPSA | 19.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.56 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|