C19H28N3S2+ — CID 7775127
3-[(2,5-dimethylphenyl)carbamothioyl-(thiophen-2-ylmethyl)amino]propyl-dimethylazanium (PubChem CID 7775127) has the molecular formula C19H28N3S2+ and a molecular weight of 362.59 g/mol. Its IUPAC name is 3-[(2,5-dimethylphenyl)carbamothioyl-(thiophen-2-ylmethyl)amino]propyl-dimethylazanium.
| Compound Name | 3-[(2,5-dimethylphenyl)carbamothioyl-(thiophen-2-ylmethyl)amino]propyl-dimethylazanium |
|---|---|
| PubChem CID | 7775127 |
| Molecular Formula | C19H28N3S2+ |
| Molecular Weight | 362.59 g/mol |
| Exact Mass | 362.17 |
| IUPAC Name | 3-[(2,5-dimethylphenyl)carbamothioyl-(thiophen-2-ylmethyl)amino]propyl-dimethylazanium |
| SMILES | Cc1ccc(C)c(NC(=S)N(CCC[NH+](C)C)Cc2cccs2)c1 |
| InChI | InChI=1S/C19H27N3S2/c1-15-8-9-16(2)18(13-15)20-19(23)22(11-6-10-21(3)4)14-17-7-5-12-24-17/h5,7-9,12-13H,6,10-11,14H2,1-4H3,(H,20,23)/p+1 |
| InChIKey | FRYDRDFKPMJEJO-UHFFFAOYSA-O |
| XLogP | 3.10 |
| TPSA | 19.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.59 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|