C22H33N3S2 — CID 3512087
1-[3-[butyl(methyl)amino]propyl]-3-(2,5-dimethylphenyl)-1-(thiophen-2-ylmethyl)thiourea (PubChem CID 3512087) has the molecular formula C22H33N3S2 and a molecular weight of 403.66 g/mol. Its IUPAC name is 1-[3-[butyl(methyl)amino]propyl]-3-(2,5-dimethylphenyl)-1-(thiophen-2-ylmethyl)thiourea.
| Compound Name | 1-[3-[butyl(methyl)amino]propyl]-3-(2,5-dimethylphenyl)-1-(thiophen-2-ylmethyl)thiourea |
|---|---|
| PubChem CID | 3512087 |
| Molecular Formula | C22H33N3S2 |
| Molecular Weight | 403.66 g/mol |
| Exact Mass | 403.21 |
| IUPAC Name | 1-[3-[butyl(methyl)amino]propyl]-3-(2,5-dimethylphenyl)-1-(thiophen-2-ylmethyl)thiourea |
| SMILES | CCCCN(C)CCCN(Cc1cccs1)C(=S)Nc1cc(C)ccc1C |
| InChI | InChI=1S/C22H33N3S2/c1-5-6-12-24(4)13-8-14-25(17-20-9-7-15-27-20)22(26)23-21-16-18(2)10-11-19(21)3/h7,9-11,15-16H,5-6,8,12-14,17H2,1-4H3,(H,23,26) |
| InChIKey | UNULHWMRBCSCAS-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.66 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|