C21H31N3S3 — CID 46504242
1-[3-[butyl(methyl)amino]propyl]-3-(3-methylsulfanylphenyl)-1-(thiophen-2-ylmethyl)thiourea (PubChem CID 46504242) has the molecular formula C21H31N3S3 and a molecular weight of 421.70 g/mol. Its IUPAC name is 1-[3-[butyl(methyl)amino]propyl]-3-(3-methylsulfanylphenyl)-1-(thiophen-2-ylmethyl)thiourea.
| Compound Name | 1-[3-[butyl(methyl)amino]propyl]-3-(3-methylsulfanylphenyl)-1-(thiophen-2-ylmethyl)thiourea |
|---|---|
| PubChem CID | 46504242 |
| Molecular Formula | C21H31N3S3 |
| Molecular Weight | 421.70 g/mol |
| Exact Mass | 421.17 |
| IUPAC Name | 1-[3-[butyl(methyl)amino]propyl]-3-(3-methylsulfanylphenyl)-1-(thiophen-2-ylmethyl)thiourea |
| SMILES | CCCCN(C)CCCN(Cc1cccs1)C(=S)Nc1cccc(SC)c1 |
| InChI | InChI=1S/C21H31N3S3/c1-4-5-12-23(2)13-8-14-24(17-20-11-7-15-27-20)21(25)22-18-9-6-10-19(16-18)26-3/h6-7,9-11,15-16H,4-5,8,12-14,17H2,1-3H3,(H,22,25) |
| InChIKey | KLCCONUMGSYDPR-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.70 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|