C18H23F2N3OS2 — CID 7943669
3-[4-(difluoromethoxy)phenyl]-1-[3-(dimethylamino)propyl]-1-(thiophen-2-ylmethyl)thiourea (PubChem CID 7943669) has the molecular formula C18H23F2N3OS2 and a molecular weight of 399.53 g/mol. Its IUPAC name is 3-[4-(difluoromethoxy)phenyl]-1-[3-(dimethylamino)propyl]-1-(thiophen-2-ylmethyl)thiourea.
| Compound Name | 3-[4-(difluoromethoxy)phenyl]-1-[3-(dimethylamino)propyl]-1-(thiophen-2-ylmethyl)thiourea |
|---|---|
| PubChem CID | 7943669 |
| Molecular Formula | C18H23F2N3OS2 |
| Molecular Weight | 399.53 g/mol |
| Exact Mass | 399.13 |
| IUPAC Name | 3-[4-(difluoromethoxy)phenyl]-1-[3-(dimethylamino)propyl]-1-(thiophen-2-ylmethyl)thiourea |
| SMILES | CN(C)CCCN(Cc1cccs1)C(=S)Nc1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C18H23F2N3OS2/c1-22(2)10-4-11-23(13-16-5-3-12-26-16)18(25)21-14-6-8-15(9-7-14)24-17(19)20/h3,5-9,12,17H,4,10-11,13H2,1-2H3,(H,21,25) |
| InChIKey | MPBAVHMCSSZNIR-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 27.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.53 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|