C18H20F2N2OS — CID 8680660
3-[4-(difluoromethoxy)phenyl]-1-[(4-ethylphenyl)methyl]-1-methylthiourea (PubChem CID 8680660) has the molecular formula C18H20F2N2OS and a molecular weight of 350.43 g/mol. Its IUPAC name is 3-[4-(difluoromethoxy)phenyl]-1-[(4-ethylphenyl)methyl]-1-methylthiourea.
| Compound Name | 3-[4-(difluoromethoxy)phenyl]-1-[(4-ethylphenyl)methyl]-1-methylthiourea |
|---|---|
| PubChem CID | 8680660 |
| Molecular Formula | C18H20F2N2OS |
| Molecular Weight | 350.43 g/mol |
| Exact Mass | 350.13 |
| IUPAC Name | 3-[4-(difluoromethoxy)phenyl]-1-[(4-ethylphenyl)methyl]-1-methylthiourea |
| SMILES | CCc1ccc(CN(C)C(=S)Nc2ccc(OC(F)F)cc2)cc1 |
| InChI | InChI=1S/C18H20F2N2OS/c1-3-13-4-6-14(7-5-13)12-22(2)18(24)21-15-8-10-16(11-9-15)23-17(19)20/h4-11,17H,3,12H2,1-2H3,(H,21,24) |
| InChIKey | WRDXSWMJFJMHOO-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.43 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|