C20H23F2NO2 — CID 78848081
3-[4-(difluoromethoxy)phenyl]-N-[(4-ethylphenyl)methyl]-N-methylpropanamide (PubChem CID 78848081) has the molecular formula C20H23F2NO2 and a molecular weight of 347.41 g/mol. Its IUPAC name is 3-[4-(difluoromethoxy)phenyl]-N-[(4-ethylphenyl)methyl]-N-methylpropanamide.
| Compound Name | 3-[4-(difluoromethoxy)phenyl]-N-[(4-ethylphenyl)methyl]-N-methylpropanamide |
|---|---|
| PubChem CID | 78848081 |
| Molecular Formula | C20H23F2NO2 |
| Molecular Weight | 347.41 g/mol |
| Exact Mass | 347.17 |
| IUPAC Name | 3-[4-(difluoromethoxy)phenyl]-N-[(4-ethylphenyl)methyl]-N-methylpropanamide |
| SMILES | CCc1ccc(CN(C)C(=O)CCc2ccc(OC(F)F)cc2)cc1 |
| InChI | InChI=1S/C20H23F2NO2/c1-3-15-4-6-17(7-5-15)14-23(2)19(24)13-10-16-8-11-18(12-9-16)25-20(21)22/h4-9,11-12,20H,3,10,13-14H2,1-2H3 |
| InChIKey | DECCKNGZCQASJI-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.41 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |