C17H26F2N2O2 — CID 119660115
N-(3-amino-4-methylpentyl)-3-[4-(difluoromethoxy)phenyl]-N-methylpropanamide (PubChem CID 119660115) has the molecular formula C17H26F2N2O2 and a molecular weight of 328.40 g/mol. Its IUPAC name is N-(3-amino-4-methylpentyl)-3-[4-(difluoromethoxy)phenyl]-N-methylpropanamide.
| Compound Name | N-(3-amino-4-methylpentyl)-3-[4-(difluoromethoxy)phenyl]-N-methylpropanamide |
|---|---|
| PubChem CID | 119660115 |
| Molecular Formula | C17H26F2N2O2 |
| Molecular Weight | 328.40 g/mol |
| Exact Mass | 328.20 |
| IUPAC Name | N-(3-amino-4-methylpentyl)-3-[4-(difluoromethoxy)phenyl]-N-methylpropanamide |
| SMILES | CC(C)C(N)CCN(C)C(=O)CCc1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C17H26F2N2O2/c1-12(2)15(20)10-11-21(3)16(22)9-6-13-4-7-14(8-5-13)23-17(18)19/h4-5,7-8,12,15,17H,6,9-11,20H2,1-3H3 |
| InChIKey | CCVSHTTUNRMJCG-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.40 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |