C20H21F2NO3 — CID 55344317
N-[[4-(difluoromethoxy)phenyl]methyl]-N-methyl-4-(4-methylphenyl)-4-oxobutanamide (PubChem CID 55344317) has the molecular formula C20H21F2NO3 and a molecular weight of 361.39 g/mol. Its IUPAC name is N-[[4-(difluoromethoxy)phenyl]methyl]-N-methyl-4-(4-methylphenyl)-4-oxobutanamide.
| Compound Name | N-[[4-(difluoromethoxy)phenyl]methyl]-N-methyl-4-(4-methylphenyl)-4-oxobutanamide |
|---|---|
| PubChem CID | 55344317 |
| Molecular Formula | C20H21F2NO3 |
| Molecular Weight | 361.39 g/mol |
| Exact Mass | 361.15 |
| IUPAC Name | N-[[4-(difluoromethoxy)phenyl]methyl]-N-methyl-4-(4-methylphenyl)-4-oxobutanamide |
| SMILES | Cc1ccc(C(=O)CCC(=O)N(C)Cc2ccc(OC(F)F)cc2)cc1 |
| InChI | InChI=1S/C20H21F2NO3/c1-14-3-7-16(8-4-14)18(24)11-12-19(25)23(2)13-15-5-9-17(10-6-15)26-20(21)22/h3-10,20H,11-13H2,1-2H3 |
| InChIKey | JJADKAVKJNDYQC-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.39 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |