C21H24F2N2O3 — CID 86922903
3-[4-(difluoromethoxy)phenyl]-N-[2-(2-ethylanilino)-2-oxoethyl]-N-methylpropanamide (PubChem CID 86922903) has the molecular formula C21H24F2N2O3 and a molecular weight of 390.43 g/mol. Its IUPAC name is 3-[4-(difluoromethoxy)phenyl]-N-[2-(2-ethylanilino)-2-oxoethyl]-N-methylpropanamide.
| Compound Name | 3-[4-(difluoromethoxy)phenyl]-N-[2-(2-ethylanilino)-2-oxoethyl]-N-methylpropanamide |
|---|---|
| PubChem CID | 86922903 |
| Molecular Formula | C21H24F2N2O3 |
| Molecular Weight | 390.43 g/mol |
| Exact Mass | 390.18 |
| IUPAC Name | 3-[4-(difluoromethoxy)phenyl]-N-[2-(2-ethylanilino)-2-oxoethyl]-N-methylpropanamide |
| SMILES | CCc1ccccc1NC(=O)CN(C)C(=O)CCc1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C21H24F2N2O3/c1-3-16-6-4-5-7-18(16)24-19(26)14-25(2)20(27)13-10-15-8-11-17(12-9-15)28-21(22)23/h4-9,11-12,21H,3,10,13-14H2,1-2H3,(H,24,26) |
| InChIKey | YVVBENUYSAJBNK-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.43 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |