C20H25F2N3OS — CID 8656417
1-[4-(difluoromethoxy)phenyl]-3-[(2R)-2-(dimethylamino)-2-(4-ethylphenyl)ethyl]thiourea (PubChem CID 8656417) has the molecular formula C20H25F2N3OS and a molecular weight of 393.50 g/mol. Its IUPAC name is 1-[4-(difluoromethoxy)phenyl]-3-[(2R)-2-(dimethylamino)-2-(4-ethylphenyl)ethyl]thiourea.
| Compound Name | 1-[4-(difluoromethoxy)phenyl]-3-[(2R)-2-(dimethylamino)-2-(4-ethylphenyl)ethyl]thiourea |
|---|---|
| PubChem CID | 8656417 |
| Molecular Formula | C20H25F2N3OS |
| Molecular Weight | 393.50 g/mol |
| Exact Mass | 393.17 |
| IUPAC Name | 1-[4-(difluoromethoxy)phenyl]-3-[(2R)-2-(dimethylamino)-2-(4-ethylphenyl)ethyl]thiourea |
| SMILES | CCc1ccc([C@H](CNC(=S)Nc2ccc(OC(F)F)cc2)N(C)C)cc1 |
| InChI | InChI=1S/C20H25F2N3OS/c1-4-14-5-7-15(8-6-14)18(25(2)3)13-23-20(27)24-16-9-11-17(12-10-16)26-19(21)22/h5-12,18-19H,4,13H2,1-3H3,(H2,23,24,27)/t18-/m0/s1 |
| InChIKey | XSPYZKOLEBGTSX-SFHVURJKSA-N |
| XLogP | 4.44 |
| TPSA | 36.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.50 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|