C19H23ClFN3OS — CID 21008720
1-(3-chloro-4-fluorophenyl)-3-[2-(dimethylamino)-2-(4-ethoxyphenyl)ethyl]thiourea (PubChem CID 21008720) has the molecular formula C19H23ClFN3OS and a molecular weight of 395.93 g/mol. Its IUPAC name is 1-(3-chloro-4-fluorophenyl)-3-[2-(dimethylamino)-2-(4-ethoxyphenyl)ethyl]thiourea.
| Compound Name | 1-(3-chloro-4-fluorophenyl)-3-[2-(dimethylamino)-2-(4-ethoxyphenyl)ethyl]thiourea |
|---|---|
| PubChem CID | 21008720 |
| Molecular Formula | C19H23ClFN3OS |
| Molecular Weight | 395.93 g/mol |
| Exact Mass | 395.12 |
| IUPAC Name | 1-(3-chloro-4-fluorophenyl)-3-[2-(dimethylamino)-2-(4-ethoxyphenyl)ethyl]thiourea |
| SMILES | CCOc1ccc(C(CNC(=S)Nc2ccc(F)c(Cl)c2)N(C)C)cc1 |
| InChI | InChI=1S/C19H23ClFN3OS/c1-4-25-15-8-5-13(6-9-15)18(24(2)3)12-22-19(26)23-14-7-10-17(21)16(20)11-14/h5-11,18H,4,12H2,1-3H3,(H2,22,23,26) |
| InChIKey | VHVNQQMKAQAMCK-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 36.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.93 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|