C16H16F2N2OS — CID 2455590
1-benzyl-3-[4-(difluoromethoxy)phenyl]-1-methylthiourea (PubChem CID 2455590) has the molecular formula C16H16F2N2OS and a molecular weight of 322.38 g/mol. Its IUPAC name is 1-benzyl-3-[4-(difluoromethoxy)phenyl]-1-methylthiourea.
| Compound Name | 1-benzyl-3-[4-(difluoromethoxy)phenyl]-1-methylthiourea |
|---|---|
| PubChem CID | 2455590 |
| Molecular Formula | C16H16F2N2OS |
| Molecular Weight | 322.38 g/mol |
| Exact Mass | 322.10 |
| IUPAC Name | 1-benzyl-3-[4-(difluoromethoxy)phenyl]-1-methylthiourea |
| SMILES | CN(Cc1ccccc1)C(=S)Nc1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C16H16F2N2OS/c1-20(11-12-5-3-2-4-6-12)16(22)19-13-7-9-14(10-8-13)21-15(17)18/h2-10,15H,11H2,1H3,(H,19,22) |
| InChIKey | KHZFRGHVMWSXEM-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.38 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|