C19H25N3O2S2 — CID 8676261
3-(1,3-benzodioxol-5-ylmethyl)-1-[3-(dimethylamino)propyl]-1-(thiophen-2-ylmethyl)thiourea (PubChem CID 8676261) has the molecular formula C19H25N3O2S2 and a molecular weight of 391.56 g/mol. Its IUPAC name is 3-(1,3-benzodioxol-5-ylmethyl)-1-[3-(dimethylamino)propyl]-1-(thiophen-2-ylmethyl)thiourea.
| Compound Name | 3-(1,3-benzodioxol-5-ylmethyl)-1-[3-(dimethylamino)propyl]-1-(thiophen-2-ylmethyl)thiourea |
|---|---|
| PubChem CID | 8676261 |
| Molecular Formula | C19H25N3O2S2 |
| Molecular Weight | 391.56 g/mol |
| Exact Mass | 391.14 |
| IUPAC Name | 3-(1,3-benzodioxol-5-ylmethyl)-1-[3-(dimethylamino)propyl]-1-(thiophen-2-ylmethyl)thiourea |
| SMILES | CN(C)CCCN(Cc1cccs1)C(=S)NCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C19H25N3O2S2/c1-21(2)8-4-9-22(13-16-5-3-10-26-16)19(25)20-12-15-6-7-17-18(11-15)24-14-23-17/h3,5-7,10-11H,4,8-9,12-14H2,1-2H3,(H,20,25) |
| InChIKey | HUAXXWNTXDEJLN-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 36.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.56 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|