C15H18N2OS2 — CID 27096610
N-(3-methylsulfanylphenyl)-2-[methyl(thiophen-2-ylmethyl)amino]acetamide (PubChem CID 27096610) has the molecular formula C15H18N2OS2 and a molecular weight of 306.46 g/mol. Its IUPAC name is N-(3-methylsulfanylphenyl)-2-[methyl(thiophen-2-ylmethyl)amino]acetamide.
| Compound Name | N-(3-methylsulfanylphenyl)-2-[methyl(thiophen-2-ylmethyl)amino]acetamide |
|---|---|
| PubChem CID | 27096610 |
| Molecular Formula | C15H18N2OS2 |
| Molecular Weight | 306.46 g/mol |
| Exact Mass | 306.09 |
| IUPAC Name | N-(3-methylsulfanylphenyl)-2-[methyl(thiophen-2-ylmethyl)amino]acetamide |
| SMILES | CSc1cccc(NC(=O)CN(C)Cc2cccs2)c1 |
| InChI | InChI=1S/C15H18N2OS2/c1-17(10-14-7-4-8-20-14)11-15(18)16-12-5-3-6-13(9-12)19-2/h3-9H,10-11H2,1-2H3,(H,16,18) |
| InChIKey | ANAMBSAQAZNCIN-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.46 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |