C19H27N3O3S2 — CID 8965560
N-[3-(diethylsulfamoyl)-4-methylphenyl]-2-[methyl(thiophen-2-ylmethyl)amino]acetamide (PubChem CID 8965560) has the molecular formula C19H27N3O3S2 and a molecular weight of 409.58 g/mol. Its IUPAC name is N-[3-(diethylsulfamoyl)-4-methylphenyl]-2-[methyl(thiophen-2-ylmethyl)amino]acetamide.
| Compound Name | N-[3-(diethylsulfamoyl)-4-methylphenyl]-2-[methyl(thiophen-2-ylmethyl)amino]acetamide |
|---|---|
| PubChem CID | 8965560 |
| Molecular Formula | C19H27N3O3S2 |
| Molecular Weight | 409.58 g/mol |
| Exact Mass | 409.15 |
| IUPAC Name | N-[3-(diethylsulfamoyl)-4-methylphenyl]-2-[methyl(thiophen-2-ylmethyl)amino]acetamide |
| SMILES | CCN(CC)S(=O)(=O)c1cc(NC(=O)CN(C)Cc2cccs2)ccc1C |
| InChI | InChI=1S/C19H27N3O3S2/c1-5-22(6-2)27(24,25)18-12-16(10-9-15(18)3)20-19(23)14-21(4)13-17-8-7-11-26-17/h7-12H,5-6,13-14H2,1-4H3,(H,20,23) |
| InChIKey | UDPLKESQZQTLEZ-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.58 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |