C18H24N2O3S3 — CID 30837668
N-[3-(diethylsulfamoyl)-4-methylphenyl]-2-(thiophen-2-ylmethylsulfanyl)acetamide (PubChem CID 30837668) has the molecular formula C18H24N2O3S3 and a molecular weight of 412.60 g/mol. Its IUPAC name is N-[3-(diethylsulfamoyl)-4-methylphenyl]-2-(thiophen-2-ylmethylsulfanyl)acetamide.
| Compound Name | N-[3-(diethylsulfamoyl)-4-methylphenyl]-2-(thiophen-2-ylmethylsulfanyl)acetamide |
|---|---|
| PubChem CID | 30837668 |
| Molecular Formula | C18H24N2O3S3 |
| Molecular Weight | 412.60 g/mol |
| Exact Mass | 412.09 |
| IUPAC Name | N-[3-(diethylsulfamoyl)-4-methylphenyl]-2-(thiophen-2-ylmethylsulfanyl)acetamide |
| SMILES | CCN(CC)S(=O)(=O)c1cc(NC(=O)CSCc2cccs2)ccc1C |
| InChI | InChI=1S/C18H24N2O3S3/c1-4-20(5-2)26(22,23)17-11-15(9-8-14(17)3)19-18(21)13-24-12-16-7-6-10-25-16/h6-11H,4-5,12-13H2,1-3H3,(H,19,21) |
| InChIKey | VOZCSMXYMRCXCF-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.60 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |