C14H20N2O2S — CID 47334614
N'-butyl-N'-methyl-N-(3-methylsulfanylphenyl)oxamide (PubChem CID 47334614) has the molecular formula C14H20N2O2S and a molecular weight of 280.39 g/mol. Its IUPAC name is N'-butyl-N'-methyl-N-(3-methylsulfanylphenyl)oxamide.
| Compound Name | N'-butyl-N'-methyl-N-(3-methylsulfanylphenyl)oxamide |
|---|---|
| PubChem CID | 47334614 |
| Molecular Formula | C14H20N2O2S |
| Molecular Weight | 280.39 g/mol |
| Exact Mass | 280.12 |
| IUPAC Name | N'-butyl-N'-methyl-N-(3-methylsulfanylphenyl)oxamide |
| SMILES | CCCCN(C)C(=O)C(=O)Nc1cccc(SC)c1 |
| InChI | InChI=1S/C14H20N2O2S/c1-4-5-9-16(2)14(18)13(17)15-11-7-6-8-12(10-11)19-3/h6-8,10H,4-5,9H2,1-3H3,(H,15,17) |
| InChIKey | JRXILUSBSNKBTK-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.39 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|