C11H14N2O3S — CID 44997522
N-(2-hydroxyethyl)-N'-(3-methylsulfanylphenyl)oxamide (PubChem CID 44997522) has the molecular formula C11H14N2O3S and a molecular weight of 254.31 g/mol. Its IUPAC name is N-(2-hydroxyethyl)-N'-(3-methylsulfanylphenyl)oxamide.
| Compound Name | N-(2-hydroxyethyl)-N'-(3-methylsulfanylphenyl)oxamide |
|---|---|
| PubChem CID | 44997522 |
| Molecular Formula | C11H14N2O3S |
| Molecular Weight | 254.31 g/mol |
| Exact Mass | 254.07 |
| IUPAC Name | N-(2-hydroxyethyl)-N'-(3-methylsulfanylphenyl)oxamide |
| SMILES | CSc1cccc(NC(=O)C(=O)NCCO)c1 |
| InChI | InChI=1S/C11H14N2O3S/c1-17-9-4-2-3-8(7-9)13-11(16)10(15)12-5-6-14/h2-4,7,14H,5-6H2,1H3,(H,12,15)(H,13,16) |
| InChIKey | LANQWIHNPDARFF-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.31 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|