C14H15N3O4S2 — CID 108520190
N-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethyl]-N'-(3-methylsulfanylphenyl)oxamide (PubChem CID 108520190) has the molecular formula C14H15N3O4S2 and a molecular weight of 353.43 g/mol. Its IUPAC name is N-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethyl]-N'-(3-methylsulfanylphenyl)oxamide.
| Compound Name | N-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethyl]-N'-(3-methylsulfanylphenyl)oxamide |
|---|---|
| PubChem CID | 108520190 |
| Molecular Formula | C14H15N3O4S2 |
| Molecular Weight | 353.43 g/mol |
| Exact Mass | 353.05 |
| IUPAC Name | N-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethyl]-N'-(3-methylsulfanylphenyl)oxamide |
| SMILES | CSc1cccc(NC(=O)C(=O)NCCN2C(=O)CSC2=O)c1 |
| InChI | InChI=1S/C14H15N3O4S2/c1-22-10-4-2-3-9(7-10)16-13(20)12(19)15-5-6-17-11(18)8-23-14(17)21/h2-4,7H,5-6,8H2,1H3,(H,15,19)(H,16,20) |
| InChIKey | KDEWZLQFTKIBBJ-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.43 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|