C18H16N2O3S2 — CID 122264511
N'-(3-methylsulfanylphenyl)-N-[(5-thiophen-2-ylfuran-2-yl)methyl]oxamide (PubChem CID 122264511) has the molecular formula C18H16N2O3S2 and a molecular weight of 372.47 g/mol. Its IUPAC name is N'-(3-methylsulfanylphenyl)-N-[(5-thiophen-2-ylfuran-2-yl)methyl]oxamide.
| Compound Name | N'-(3-methylsulfanylphenyl)-N-[(5-thiophen-2-ylfuran-2-yl)methyl]oxamide |
|---|---|
| PubChem CID | 122264511 |
| Molecular Formula | C18H16N2O3S2 |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.06 |
| IUPAC Name | N'-(3-methylsulfanylphenyl)-N-[(5-thiophen-2-ylfuran-2-yl)methyl]oxamide |
| SMILES | CSc1cccc(NC(=O)C(=O)NCc2ccc(-c3cccs3)o2)c1 |
| InChI | InChI=1S/C18H16N2O3S2/c1-24-14-5-2-4-12(10-14)20-18(22)17(21)19-11-13-7-8-15(23-13)16-6-3-9-25-16/h2-10H,11H2,1H3,(H,19,21)(H,20,22) |
| InChIKey | DSVOKMFDBTWJIQ-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|