C18H15ClN2O3S — CID 122264516
N'-(5-chloro-2-methylphenyl)-N-[(5-thiophen-2-ylfuran-2-yl)methyl]oxamide (PubChem CID 122264516) has the molecular formula C18H15ClN2O3S and a molecular weight of 374.85 g/mol. Its IUPAC name is N'-(5-chloro-2-methylphenyl)-N-[(5-thiophen-2-ylfuran-2-yl)methyl]oxamide.
| Compound Name | N'-(5-chloro-2-methylphenyl)-N-[(5-thiophen-2-ylfuran-2-yl)methyl]oxamide |
|---|---|
| PubChem CID | 122264516 |
| Molecular Formula | C18H15ClN2O3S |
| Molecular Weight | 374.85 g/mol |
| Exact Mass | 374.05 |
| IUPAC Name | N'-(5-chloro-2-methylphenyl)-N-[(5-thiophen-2-ylfuran-2-yl)methyl]oxamide |
| SMILES | Cc1ccc(Cl)cc1NC(=O)C(=O)NCc1ccc(-c2cccs2)o1 |
| InChI | InChI=1S/C18H15ClN2O3S/c1-11-4-5-12(19)9-14(11)21-18(23)17(22)20-10-13-6-7-15(24-13)16-3-2-8-25-16/h2-9H,10H2,1H3,(H,20,22)(H,21,23) |
| InChIKey | BFQSAXYMKXPMCK-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.85 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|