C19H18N2O3S — CID 122264488
N'-(3,5-dimethylphenyl)-N-[(5-thiophen-2-ylfuran-2-yl)methyl]oxamide (PubChem CID 122264488) has the molecular formula C19H18N2O3S and a molecular weight of 354.43 g/mol. Its IUPAC name is N'-(3,5-dimethylphenyl)-N-[(5-thiophen-2-ylfuran-2-yl)methyl]oxamide.
| Compound Name | N'-(3,5-dimethylphenyl)-N-[(5-thiophen-2-ylfuran-2-yl)methyl]oxamide |
|---|---|
| PubChem CID | 122264488 |
| Molecular Formula | C19H18N2O3S |
| Molecular Weight | 354.43 g/mol |
| Exact Mass | 354.10 |
| IUPAC Name | N'-(3,5-dimethylphenyl)-N-[(5-thiophen-2-ylfuran-2-yl)methyl]oxamide |
| SMILES | Cc1cc(C)cc(NC(=O)C(=O)NCc2ccc(-c3cccs3)o2)c1 |
| InChI | InChI=1S/C19H18N2O3S/c1-12-8-13(2)10-14(9-12)21-19(23)18(22)20-11-15-5-6-16(24-15)17-4-3-7-25-17/h3-10H,11H2,1-2H3,(H,20,22)(H,21,23) |
| InChIKey | CRHKVRCNOJYEOJ-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.43 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|