C14H14N2O3S — CID 122264467
N'-cyclopropyl-N-[(5-thiophen-2-ylfuran-2-yl)methyl]oxamide (PubChem CID 122264467) has the molecular formula C14H14N2O3S and a molecular weight of 290.34 g/mol. Its IUPAC name is N'-cyclopropyl-N-[(5-thiophen-2-ylfuran-2-yl)methyl]oxamide.
| Compound Name | N'-cyclopropyl-N-[(5-thiophen-2-ylfuran-2-yl)methyl]oxamide |
|---|---|
| PubChem CID | 122264467 |
| Molecular Formula | C14H14N2O3S |
| Molecular Weight | 290.34 g/mol |
| Exact Mass | 290.07 |
| IUPAC Name | N'-cyclopropyl-N-[(5-thiophen-2-ylfuran-2-yl)methyl]oxamide |
| SMILES | O=C(NCc1ccc(-c2cccs2)o1)C(=O)NC1CC1 |
| InChI | InChI=1S/C14H14N2O3S/c17-13(14(18)16-9-3-4-9)15-8-10-5-6-11(19-10)12-2-1-7-20-12/h1-2,5-7,9H,3-4,8H2,(H,15,17)(H,16,18) |
| InChIKey | MLQCXJCJYWDANG-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.34 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|