C23H19NO2S — CID 122264322
2,2-diphenyl-N-[(5-thiophen-2-ylfuran-2-yl)methyl]acetamide (PubChem CID 122264322) has the molecular formula C23H19NO2S and a molecular weight of 373.48 g/mol. Its IUPAC name is 2,2-diphenyl-N-[(5-thiophen-2-ylfuran-2-yl)methyl]acetamide.
| Compound Name | 2,2-diphenyl-N-[(5-thiophen-2-ylfuran-2-yl)methyl]acetamide |
|---|---|
| PubChem CID | 122264322 |
| Molecular Formula | C23H19NO2S |
| Molecular Weight | 373.48 g/mol |
| Exact Mass | 373.11 |
| IUPAC Name | 2,2-diphenyl-N-[(5-thiophen-2-ylfuran-2-yl)methyl]acetamide |
| SMILES | O=C(NCc1ccc(-c2cccs2)o1)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H19NO2S/c25-23(24-16-19-13-14-20(26-19)21-12-7-15-27-21)22(17-8-3-1-4-9-17)18-10-5-2-6-11-18/h1-15,22H,16H2,(H,24,25) |
| InChIKey | BOSZTCMGUUUKNA-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.48 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |