C18H13NO2S2 — CID 122264352
N-[(5-thiophen-2-ylfuran-2-yl)methyl]-1-benzothiophene-2-carboxamide (PubChem CID 122264352) has the molecular formula C18H13NO2S2 and a molecular weight of 339.44 g/mol. Its IUPAC name is N-[(5-thiophen-2-ylfuran-2-yl)methyl]-1-benzothiophene-2-carboxamide.
| Compound Name | N-[(5-thiophen-2-ylfuran-2-yl)methyl]-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 122264352 |
| Molecular Formula | C18H13NO2S2 |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.04 |
| IUPAC Name | N-[(5-thiophen-2-ylfuran-2-yl)methyl]-1-benzothiophene-2-carboxamide |
| SMILES | O=C(NCc1ccc(-c2cccs2)o1)c1cc2ccccc2s1 |
| InChI | InChI=1S/C18H13NO2S2/c20-18(17-10-12-4-1-2-5-15(12)23-17)19-11-13-7-8-14(21-13)16-6-3-9-22-16/h1-10H,11H2,(H,19,20) |
| InChIKey | HVVOPWZDIGBOOK-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |