C20H15NO5S — CID 122264327
8-methoxy-2-oxo-N-[(5-thiophen-2-ylfuran-2-yl)methyl]chromene-3-carboxamide (PubChem CID 122264327) has the molecular formula C20H15NO5S and a molecular weight of 381.41 g/mol. Its IUPAC name is 8-methoxy-2-oxo-N-[(5-thiophen-2-ylfuran-2-yl)methyl]chromene-3-carboxamide.
| Compound Name | 8-methoxy-2-oxo-N-[(5-thiophen-2-ylfuran-2-yl)methyl]chromene-3-carboxamide |
|---|---|
| PubChem CID | 122264327 |
| Molecular Formula | C20H15NO5S |
| Molecular Weight | 381.41 g/mol |
| Exact Mass | 381.07 |
| IUPAC Name | 8-methoxy-2-oxo-N-[(5-thiophen-2-ylfuran-2-yl)methyl]chromene-3-carboxamide |
| SMILES | COc1cccc2cc(C(=O)NCc3ccc(-c4cccs4)o3)c(=O)oc12 |
| InChI | InChI=1S/C20H15NO5S/c1-24-16-5-2-4-12-10-14(20(23)26-18(12)16)19(22)21-11-13-7-8-15(25-13)17-6-3-9-27-17/h2-10H,11H2,1H3,(H,21,22) |
| InChIKey | TZFPGKSDJQYXOH-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 81.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.41 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|