C21H17NO5S2 — CID 121170131
N-(2-hydroxy-2-thiophen-2-yl-2-thiophen-3-ylethyl)-8-methoxy-2-oxochromene-3-carboxamide (PubChem CID 121170131) has the molecular formula C21H17NO5S2 and a molecular weight of 427.50 g/mol. Its IUPAC name is N-(2-hydroxy-2-thiophen-2-yl-2-thiophen-3-ylethyl)-8-methoxy-2-oxochromene-3-carboxamide.
| Compound Name | N-(2-hydroxy-2-thiophen-2-yl-2-thiophen-3-ylethyl)-8-methoxy-2-oxochromene-3-carboxamide |
|---|---|
| PubChem CID | 121170131 |
| Molecular Formula | C21H17NO5S2 |
| Molecular Weight | 427.50 g/mol |
| Exact Mass | 427.05 |
| IUPAC Name | N-(2-hydroxy-2-thiophen-2-yl-2-thiophen-3-ylethyl)-8-methoxy-2-oxochromene-3-carboxamide |
| SMILES | COc1cccc2cc(C(=O)NCC(O)(c3ccsc3)c3cccs3)c(=O)oc12 |
| InChI | InChI=1S/C21H17NO5S2/c1-26-16-5-2-4-13-10-15(20(24)27-18(13)16)19(23)22-12-21(25,14-7-9-28-11-14)17-6-3-8-29-17/h2-11,25H,12H2,1H3,(H,22,23) |
| InChIKey | YUVHPTSBQCDRAI-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 88.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.50 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|