C20H17F2NO6 — CID 39966511
N-[[4-(difluoromethoxy)-3-methoxyphenyl]methyl]-8-methoxy-2-oxochromene-3-carboxamide (PubChem CID 39966511) has the molecular formula C20H17F2NO6 and a molecular weight of 405.35 g/mol. Its IUPAC name is N-[[4-(difluoromethoxy)-3-methoxyphenyl]methyl]-8-methoxy-2-oxochromene-3-carboxamide.
| Compound Name | N-[[4-(difluoromethoxy)-3-methoxyphenyl]methyl]-8-methoxy-2-oxochromene-3-carboxamide |
|---|---|
| PubChem CID | 39966511 |
| Molecular Formula | C20H17F2NO6 |
| Molecular Weight | 405.35 g/mol |
| Exact Mass | 405.10 |
| IUPAC Name | N-[[4-(difluoromethoxy)-3-methoxyphenyl]methyl]-8-methoxy-2-oxochromene-3-carboxamide |
| SMILES | COc1cc(CNC(=O)c2cc3cccc(OC)c3oc2=O)ccc1OC(F)F |
| InChI | InChI=1S/C20H17F2NO6/c1-26-15-5-3-4-12-9-13(19(25)29-17(12)15)18(24)23-10-11-6-7-14(28-20(21)22)16(8-11)27-2/h3-9,20H,10H2,1-2H3,(H,23,24) |
| InChIKey | BQBDCZZUDYWNQG-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 87.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.35 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|