C18H18N2O4S — CID 122264568
1-(2,3-dimethoxyphenyl)-3-[(5-thiophen-2-ylfuran-2-yl)methyl]urea (PubChem CID 122264568) has the molecular formula C18H18N2O4S and a molecular weight of 358.42 g/mol. Its IUPAC name is 1-(2,3-dimethoxyphenyl)-3-[(5-thiophen-2-ylfuran-2-yl)methyl]urea.
| Compound Name | 1-(2,3-dimethoxyphenyl)-3-[(5-thiophen-2-ylfuran-2-yl)methyl]urea |
|---|---|
| PubChem CID | 122264568 |
| Molecular Formula | C18H18N2O4S |
| Molecular Weight | 358.42 g/mol |
| Exact Mass | 358.10 |
| IUPAC Name | 1-(2,3-dimethoxyphenyl)-3-[(5-thiophen-2-ylfuran-2-yl)methyl]urea |
| SMILES | COc1cccc(NC(=O)NCc2ccc(-c3cccs3)o2)c1OC |
| InChI | InChI=1S/C18H18N2O4S/c1-22-15-6-3-5-13(17(15)23-2)20-18(21)19-11-12-8-9-14(24-12)16-7-4-10-25-16/h3-10H,11H2,1-2H3,(H2,19,20,21) |
| InChIKey | UGIVLMSYKNBKDS-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 72.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.42 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |