C25H20BrNO2 — CID 17335196
N-[[5-(4-bromophenyl)furan-2-yl]methyl]-2,2-diphenylacetamide (PubChem CID 17335196) has the molecular formula C25H20BrNO2 and a molecular weight of 446.34 g/mol. Its IUPAC name is N-[[5-(4-bromophenyl)furan-2-yl]methyl]-2,2-diphenylacetamide.
| Compound Name | N-[[5-(4-bromophenyl)furan-2-yl]methyl]-2,2-diphenylacetamide |
|---|---|
| PubChem CID | 17335196 |
| Molecular Formula | C25H20BrNO2 |
| Molecular Weight | 446.34 g/mol |
| Exact Mass | 445.07 |
| IUPAC Name | N-[[5-(4-bromophenyl)furan-2-yl]methyl]-2,2-diphenylacetamide |
| SMILES | O=C(NCc1ccc(-c2ccc(Br)cc2)o1)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H20BrNO2/c26-21-13-11-18(12-14-21)23-16-15-22(29-23)17-27-25(28)24(19-7-3-1-4-8-19)20-9-5-2-6-10-20/h1-16,24H,17H2,(H,27,28) |
| InChIKey | ZSCRAPKBERCBFF-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.34 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |