C22H21BrN2O4 — CID 24588390
(2S)-N-[[5-(4-bromophenyl)furan-2-yl]methyl]-2-(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)propanamide (PubChem CID 24588390) has the molecular formula C22H21BrN2O4 and a molecular weight of 457.32 g/mol. Its IUPAC name is (2S)-N-[[5-(4-bromophenyl)furan-2-yl]methyl]-2-(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)propanamide.
| Compound Name | (2S)-N-[[5-(4-bromophenyl)furan-2-yl]methyl]-2-(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)propanamide |
|---|---|
| PubChem CID | 24588390 |
| Molecular Formula | C22H21BrN2O4 |
| Molecular Weight | 457.32 g/mol |
| Exact Mass | 456.07 |
| IUPAC Name | (2S)-N-[[5-(4-bromophenyl)furan-2-yl]methyl]-2-(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)propanamide |
| SMILES | C[C@@H](C(=O)NCc1ccc(-c2ccc(Br)cc2)o1)N1C(=O)C2CC=CCC2C1=O |
| InChI | InChI=1S/C22H21BrN2O4/c1-13(25-21(27)17-4-2-3-5-18(17)22(25)28)20(26)24-12-16-10-11-19(29-16)14-6-8-15(23)9-7-14/h2-3,6-11,13,17-18H,4-5,12H2,1H3,(H,24,26)/t13-,17?,18?/m0/s1 |
| InChIKey | BCSRZTWLBHCMHA-TZYSRNFLSA-N |
| XLogP | 3.66 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.32 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|