C18H18Cl2N2O3 — CID 7611715
(2S)-2-[(3aS,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]-N-[(2,4-dichlorophenyl)methyl]propanamide (PubChem CID 7611715) has the molecular formula C18H18Cl2N2O3 and a molecular weight of 381.26 g/mol. Its IUPAC name is (2S)-2-[(3aS,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]-N-[(2,4-dichlorophenyl)methyl]propanamide.
| Compound Name | (2S)-2-[(3aS,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]-N-[(2,4-dichlorophenyl)methyl]propanamide |
|---|---|
| PubChem CID | 7611715 |
| Molecular Formula | C18H18Cl2N2O3 |
| Molecular Weight | 381.26 g/mol |
| Exact Mass | 380.07 |
| IUPAC Name | (2S)-2-[(3aS,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]-N-[(2,4-dichlorophenyl)methyl]propanamide |
| SMILES | C[C@@H](C(=O)NCc1ccc(Cl)cc1Cl)N1C(=O)[C@H]2CC=CC[C@@H]2C1=O |
| InChI | InChI=1S/C18H18Cl2N2O3/c1-10(16(23)21-9-11-6-7-12(19)8-15(11)20)22-17(24)13-4-2-3-5-14(13)18(22)25/h2-3,6-8,10,13-14H,4-5,9H2,1H3,(H,21,23)/t10-,13-,14-/m0/s1 |
| InChIKey | OUGKAESAOGFLJA-BPNCWPANSA-N |
| XLogP | 2.95 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.26 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|