C18H18ClN3O4 — CID 7812731
N'-[(2S)-2-[(3aR,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]propanoyl]-4-chlorobenzohydrazide (PubChem CID 7812731) has the molecular formula C18H18ClN3O4 and a molecular weight of 375.81 g/mol. Its IUPAC name is N'-[(2S)-2-[(3aR,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]propanoyl]-4-chlorobenzohydrazide.
| Compound Name | N'-[(2S)-2-[(3aR,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]propanoyl]-4-chlorobenzohydrazide |
|---|---|
| PubChem CID | 7812731 |
| Molecular Formula | C18H18ClN3O4 |
| Molecular Weight | 375.81 g/mol |
| Exact Mass | 375.10 |
| IUPAC Name | N'-[(2S)-2-[(3aR,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]propanoyl]-4-chlorobenzohydrazide |
| SMILES | C[C@@H](C(=O)NNC(=O)c1ccc(Cl)cc1)N1C(=O)[C@H]2CC=CC[C@H]2C1=O |
| InChI | InChI=1S/C18H18ClN3O4/c1-10(22-17(25)13-4-2-3-5-14(13)18(22)26)15(23)20-21-16(24)11-6-8-12(19)9-7-11/h2-3,6-10,13-14H,4-5H2,1H3,(H,20,23)(H,21,24)/t10-,13-,14+/m0/s1 |
| InChIKey | NZGSVIUALPKHDV-LEWSCRJBSA-N |
| XLogP | 1.44 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.81 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|