C17H16Cl3N3O3 — CID 6600067
(2S)-2-[(3aS,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]-N'-(2,4,6-trichlorophenyl)propanehydrazide (PubChem CID 6600067) has the molecular formula C17H16Cl3N3O3 and a molecular weight of 416.69 g/mol. Its IUPAC name is (2S)-2-[(3aS,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]-N'-(2,4,6-trichlorophenyl)propanehydrazide.
| Compound Name | (2S)-2-[(3aS,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]-N'-(2,4,6-trichlorophenyl)propanehydrazide |
|---|---|
| PubChem CID | 6600067 |
| Molecular Formula | C17H16Cl3N3O3 |
| Molecular Weight | 416.69 g/mol |
| Exact Mass | 415.03 |
| IUPAC Name | (2S)-2-[(3aS,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]-N'-(2,4,6-trichlorophenyl)propanehydrazide |
| SMILES | C[C@@H](C(=O)NNc1c(Cl)cc(Cl)cc1Cl)N1C(=O)[C@H]2CC=CC[C@@H]2C1=O |
| InChI | InChI=1S/C17H16Cl3N3O3/c1-8(23-16(25)10-4-2-3-5-11(10)17(23)26)15(24)22-21-14-12(19)6-9(18)7-13(14)20/h2-3,6-8,10-11,21H,4-5H2,1H3,(H,22,24)/t8-,10-,11-/m0/s1 |
| InChIKey | MMSQWQTXKAUUIT-LSJOCFKGSA-N |
| XLogP | 3.43 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.69 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|