C21H23ClN2O5 — CID 7572463
[2-(2-chloro-4,6-dimethylanilino)-2-oxoethyl] (2S)-2-[(3aR,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]propanoate (PubChem CID 7572463) has the molecular formula C21H23ClN2O5 and a molecular weight of 418.88 g/mol. Its IUPAC name is [2-(2-chloro-4,6-dimethylanilino)-2-oxoethyl] (2S)-2-[(3aR,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]propanoate.
| Compound Name | [2-(2-chloro-4,6-dimethylanilino)-2-oxoethyl] (2S)-2-[(3aR,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]propanoate |
|---|---|
| PubChem CID | 7572463 |
| Molecular Formula | C21H23ClN2O5 |
| Molecular Weight | 418.88 g/mol |
| Exact Mass | 418.13 |
| IUPAC Name | [2-(2-chloro-4,6-dimethylanilino)-2-oxoethyl] (2S)-2-[(3aR,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]propanoate |
| SMILES | Cc1cc(C)c(NC(=O)COC(=O)[C@H](C)N2C(=O)[C@H]3CC=CC[C@H]3C2=O)c(Cl)c1 |
| InChI | InChI=1S/C21H23ClN2O5/c1-11-8-12(2)18(16(22)9-11)23-17(25)10-29-21(28)13(3)24-19(26)14-6-4-5-7-15(14)20(24)27/h4-5,8-9,13-15H,6-7,10H2,1-3H3,(H,23,25)/t13-,14-,15+/m0/s1 |
| InChIKey | FETLNUDKYBDQEO-SOUVJXGZSA-N |
| XLogP | 2.78 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.88 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|