C17H21N3O6 — CID 8846140
[2-(cyclopropylcarbamoylamino)-2-oxoethyl] (2S)-2-[(3aS,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]propanoate (PubChem CID 8846140) has the molecular formula C17H21N3O6 and a molecular weight of 363.37 g/mol. Its IUPAC name is [2-(cyclopropylcarbamoylamino)-2-oxoethyl] (2S)-2-[(3aS,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]propanoate.
| Compound Name | [2-(cyclopropylcarbamoylamino)-2-oxoethyl] (2S)-2-[(3aS,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]propanoate |
|---|---|
| PubChem CID | 8846140 |
| Molecular Formula | C17H21N3O6 |
| Molecular Weight | 363.37 g/mol |
| Exact Mass | 363.14 |
| IUPAC Name | [2-(cyclopropylcarbamoylamino)-2-oxoethyl] (2S)-2-[(3aS,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]propanoate |
| SMILES | C[C@@H](C(=O)OCC(=O)NC(=O)NC1CC1)N1C(=O)[C@H]2CC=CC[C@@H]2C1=O |
| InChI | InChI=1S/C17H21N3O6/c1-9(20-14(22)11-4-2-3-5-12(11)15(20)23)16(24)26-8-13(21)19-17(25)18-10-6-7-10/h2-3,9-12H,4-8H2,1H3,(H2,18,19,21,25)/t9-,11-,12-/m0/s1 |
| InChIKey | HZZLRYRWRXEPQY-DLOVCJGASA-N |
| XLogP | -0.14 |
| TPSA | 121.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.37 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|