C23H30N2O5 — CID 7572103
[2-(1-adamantylamino)-2-oxoethyl] (2S)-2-[(3aS,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]propanoate (PubChem CID 7572103) has the molecular formula C23H30N2O5 and a molecular weight of 414.50 g/mol. Its IUPAC name is [2-(1-adamantylamino)-2-oxoethyl] (2S)-2-[(3aS,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]propanoate.
| Compound Name | [2-(1-adamantylamino)-2-oxoethyl] (2S)-2-[(3aS,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]propanoate |
|---|---|
| PubChem CID | 7572103 |
| Molecular Formula | C23H30N2O5 |
| Molecular Weight | 414.50 g/mol |
| Exact Mass | 414.22 |
| IUPAC Name | [2-(1-adamantylamino)-2-oxoethyl] (2S)-2-[(3aS,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]propanoate |
| SMILES | C[C@@H](C(=O)OCC(=O)NC12CC3CC(CC(C3)C1)C2)N1C(=O)[C@H]2CC=CC[C@@H]2C1=O |
| InChI | InChI=1S/C23H30N2O5/c1-13(25-20(27)17-4-2-3-5-18(17)21(25)28)22(29)30-12-19(26)24-23-9-14-6-15(10-23)8-16(7-14)11-23/h2-3,13-18H,4-12H2,1H3,(H,24,26)/t13-,14?,15?,16?,17-,18-,23?/m0/s1 |
| InChIKey | XNHZECVTGQLNKY-OHZWPDPMSA-N |
| XLogP | 1.95 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.50 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|