C13H17Cl3N4O2 — CID 5182658
[3-methyl-1-oxo-1-[2-(2,4,6-trichlorophenyl)hydrazinyl]pentan-2-yl]urea (PubChem CID 5182658) has the molecular formula C13H17Cl3N4O2 and a molecular weight of 367.66 g/mol. Its IUPAC name is [3-methyl-1-oxo-1-[2-(2,4,6-trichlorophenyl)hydrazinyl]pentan-2-yl]urea.
| Compound Name | [3-methyl-1-oxo-1-[2-(2,4,6-trichlorophenyl)hydrazinyl]pentan-2-yl]urea |
|---|---|
| PubChem CID | 5182658 |
| Molecular Formula | C13H17Cl3N4O2 |
| Molecular Weight | 367.66 g/mol |
| Exact Mass | 366.04 |
| IUPAC Name | [3-methyl-1-oxo-1-[2-(2,4,6-trichlorophenyl)hydrazinyl]pentan-2-yl]urea |
| SMILES | CCC(C)C(NC(N)=O)C(=O)NNc1c(Cl)cc(Cl)cc1Cl |
| InChI | InChI=1S/C13H17Cl3N4O2/c1-3-6(2)10(18-13(17)22)12(21)20-19-11-8(15)4-7(14)5-9(11)16/h4-6,10,19H,3H2,1-2H3,(H,20,21)(H3,17,18,22) |
| InChIKey | ZLOFYHLTOFCOHI-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.66 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|