C9H9Cl3N4O2 — CID 18288669
[2-oxo-2-[2-(2,4,6-trichlorophenyl)hydrazinyl]ethyl]urea (PubChem CID 18288669) has the molecular formula C9H9Cl3N4O2 and a molecular weight of 311.56 g/mol. Its IUPAC name is [2-oxo-2-[2-(2,4,6-trichlorophenyl)hydrazinyl]ethyl]urea.
| Compound Name | [2-oxo-2-[2-(2,4,6-trichlorophenyl)hydrazinyl]ethyl]urea |
|---|---|
| PubChem CID | 18288669 |
| Molecular Formula | C9H9Cl3N4O2 |
| Molecular Weight | 311.56 g/mol |
| Exact Mass | 309.98 |
| IUPAC Name | [2-oxo-2-[2-(2,4,6-trichlorophenyl)hydrazinyl]ethyl]urea |
| SMILES | NC(=O)NCC(=O)NNc1c(Cl)cc(Cl)cc1Cl |
| InChI | InChI=1S/C9H9Cl3N4O2/c10-4-1-5(11)8(6(12)2-4)16-15-7(17)3-14-9(13)18/h1-2,16H,3H2,(H,15,17)(H3,13,14,18) |
| InChIKey | HRYVUKQKUQXXJW-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.56 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|