C13H13Cl3N2O — CID 47113407
2-cyclopent-2-en-1-yl-N'-(2,4,6-trichlorophenyl)acetohydrazide (PubChem CID 47113407) has the molecular formula C13H13Cl3N2O and a molecular weight of 319.62 g/mol. Its IUPAC name is 2-cyclopent-2-en-1-yl-N'-(2,4,6-trichlorophenyl)acetohydrazide.
| Compound Name | 2-cyclopent-2-en-1-yl-N'-(2,4,6-trichlorophenyl)acetohydrazide |
|---|---|
| PubChem CID | 47113407 |
| Molecular Formula | C13H13Cl3N2O |
| Molecular Weight | 319.62 g/mol |
| Exact Mass | 318.01 |
| IUPAC Name | 2-cyclopent-2-en-1-yl-N'-(2,4,6-trichlorophenyl)acetohydrazide |
| SMILES | O=C(CC1C=CCC1)NNc1c(Cl)cc(Cl)cc1Cl |
| InChI | InChI=1S/C13H13Cl3N2O/c14-9-6-10(15)13(11(16)7-9)18-17-12(19)5-8-3-1-2-4-8/h1,3,6-8,18H,2,4-5H2,(H,17,19) |
| InChIKey | BPXXRVPIKSQLPQ-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.62 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|