C14H14BrFN2O2 — CID 94194107
2-bromo-N'-[2-[(1R)-cyclopent-2-en-1-yl]acetyl]-4-fluorobenzohydrazide (PubChem CID 94194107) has the molecular formula C14H14BrFN2O2 and a molecular weight of 341.18 g/mol. Its IUPAC name is 2-bromo-N'-[2-[(1R)-cyclopent-2-en-1-yl]acetyl]-4-fluorobenzohydrazide.
| Compound Name | 2-bromo-N'-[2-[(1R)-cyclopent-2-en-1-yl]acetyl]-4-fluorobenzohydrazide |
|---|---|
| PubChem CID | 94194107 |
| Molecular Formula | C14H14BrFN2O2 |
| Molecular Weight | 341.18 g/mol |
| Exact Mass | 340.02 |
| IUPAC Name | 2-bromo-N'-[2-[(1R)-cyclopent-2-en-1-yl]acetyl]-4-fluorobenzohydrazide |
| SMILES | O=C(C[C@@H]1C=CCC1)NNC(=O)c1ccc(F)cc1Br |
| InChI | InChI=1S/C14H14BrFN2O2/c15-12-8-10(16)5-6-11(12)14(20)18-17-13(19)7-9-3-1-2-4-9/h1,3,5-6,8-9H,2,4,7H2,(H,17,19)(H,18,20)/t9-/m1/s1 |
| InChIKey | ZOMWWLUBZFPGIE-SECBINFHSA-N |
| XLogP | 2.71 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.18 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|